| Name | 2-Fluorobenzoyl chloride |
| Synonyms | NSC 88304 2-Fluorobenzoyl 2-Fluorobenzoyl chlo 2-Fluorbenzoylchlorid 2-Fluorobenzoyl chloride o-Fluorobenzoyl chloride Orthofluorine benzoyl chloride o-fluorobenzenecarbonyl chloride 2-Fluorobenzenecarbonyl Chloride |
| CAS | 393-52-2 |
| EINECS | 206-887-2 |
| InChI | InChI:1S/C7H4ClFO/c8-7(10)5-3-1-2-4-6(5)9/h1-4H |
| Molecular Formula | C7H4ClFO |
| Molar Mass | 158.56 |
| Density | 1.328 g/mL at 25 °C (lit.) |
| Melting Point | 4 °C (lit.) |
| Boling Point | 90-92 °C/15 mmHg (lit.) |
| Flash Point | 180°F |
| Water Solubility | Decomposition |
| Solubility | Chloroform (Slightly) |
| Vapor Presure | 8.22E-06mmHg at 25°C |
| Appearance | Liquid |
| Specific Gravity | 1.328 |
| Color | Clear colorless to faintly colored |
| BRN | 636864 |
| Storage Condition | Inert atmosphere,Room Temperature |
| Sensitive | Lachrymatory |
| Refractive Index | n20/D 1.536(lit.) |
| Physical and Chemical Properties | Colorless liquid. Boiling Point: 90 ℃-92 ℃, Melting Point: 4 ℃, Flash point: 82 ℃, refractive index: 1.5365, specific gravity: 1.328. |
| Use | Used as dye, pesticide, pharmaceutical intermediates |
| Hazard Symbols | C - Corrosive![]() |
| Risk Codes | R34 - Causes burns R37 - Irritating to the respiratory system R36/37 - Irritating to eyes and respiratory system. R14 - Reacts violently with water |
| Safety Description | S26 - In case of contact with eyes, rinse immediately with plenty of water and seek medical advice. S36/37/39 - Wear suitable protective clothing, gloves and eye/face protection. S45 - In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) S28A - S27 - Take off immediately all contaminated clothing. |
| UN IDs | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| RTECS | DM6640000 |
| FLUKA BRAND F CODES | 10-19-21 |
| TSCA | Yes |
| HS Code | 29163900 |
| Hazard Note | Corrosive/Lachrymatory |
| Hazard Class | 8 |
| Packing Group | II |
| Raw Materials | o-Fluorotoluene |
| NIST chemical information | Information provided by: webbook.nist.gov (external link) |
| EPA chemical information | Information provided by: ofmpub.epa.gov (external link) |
| use | pharmaceutical and pesticide intermediates. Used as dye, pesticide, pharmaceutical intermediate |
| toxic substance data | information provided by: pubchem.ncbi.nlm.nih.gov (external link) |